C14H14ClF2N5O — CID 167425997
3-[[2-chloro-5-[1-(difluoromethyl)pyrazol-3-yl]-4-pyridinyl]amino]piperidin-2-one (PubChem CID 167425997) has the molecular formula C14H14ClF2N5O and a molecular weight of 341.75 g/mol. Its IUPAC name is 3-[[2-chloro-5-[1-(difluoromethyl)pyrazol-3-yl]-4-pyridinyl]amino]piperidin-2-one.
| Compound Name | 3-[[2-chloro-5-[1-(difluoromethyl)pyrazol-3-yl]-4-pyridinyl]amino]piperidin-2-one |
|---|---|
| PubChem CID | 167425997 |
| Molecular Formula | C14H14ClF2N5O |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 3-[[2-chloro-5-[1-(difluoromethyl)pyrazol-3-yl]-4-pyridinyl]amino]piperidin-2-one |
| SMILES | O=C1NCCCC1Nc1cc(Cl)ncc1-c1ccn(C(F)F)n1 |
| InChI | InChI=1S/C14H14ClF2N5O/c15-12-6-11(20-10-2-1-4-18-13(10)23)8(7-19-12)9-3-5-22(21-9)14(16)17/h3,5-7,10,14H,1-2,4H2,(H,18,23)(H,19,20) |
| InChIKey | UWFOCYCKRAZGHR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|