C11H14FN3O — CID 62093075
3-(4-amino-2-fluoroanilino)piperidin-2-one (PubChem CID 62093075) has the molecular formula C11H14FN3O and a molecular weight of 223.25 g/mol. Its IUPAC name is 3-(4-amino-2-fluoroanilino)piperidin-2-one.
| Compound Name | 3-(4-amino-2-fluoroanilino)piperidin-2-one |
|---|---|
| PubChem CID | 62093075 |
| Molecular Formula | C11H14FN3O |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-(4-amino-2-fluoroanilino)piperidin-2-one |
| SMILES | Nc1ccc(NC2CCCNC2=O)c(F)c1 |
| InChI | InChI=1S/C11H14FN3O/c12-8-6-7(13)3-4-9(8)15-10-2-1-5-14-11(10)16/h3-4,6,10,15H,1-2,5,13H2,(H,14,16) |
| InChIKey | JIYZAJDXWLTRGM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|