C11H13F2N3O — CID 113325264
3-(2-amino-3,5-difluoroanilino)piperidin-2-one (PubChem CID 113325264) has the molecular formula C11H13F2N3O and a molecular weight of 241.24 g/mol. Its IUPAC name is 3-(2-amino-3,5-difluoroanilino)piperidin-2-one.
| Compound Name | 3-(2-amino-3,5-difluoroanilino)piperidin-2-one |
|---|---|
| PubChem CID | 113325264 |
| Molecular Formula | C11H13F2N3O |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3-(2-amino-3,5-difluoroanilino)piperidin-2-one |
| SMILES | Nc1c(F)cc(F)cc1NC1CCCNC1=O |
| InChI | InChI=1S/C11H13F2N3O/c12-6-4-7(13)10(14)9(5-6)16-8-2-1-3-15-11(8)17/h4-5,8,16H,1-3,14H2,(H,15,17) |
| InChIKey | WZWHUNTZNKZQSM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|