About 3-(2-amino-3,5-difluoroanilino)piperidin-2-one
3-(2-amino-3,5-difluoroanilino)piperidin-2-one (PubChem CID 113325264) has the molecular formula C11H13F2N3O
and a molecular weight of 241.24 g/mol. Its IUPAC name is 3-(2-amino-3,5-difluoroanilino)piperidin-2-one.
Molecular Properties
| Compound Name | 3-(2-amino-3,5-difluoroanilino)piperidin-2-one |
| PubChem CID | 113325264 |
| Molecular Formula | C11H13F2N3O |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3-(2-amino-3,5-difluoroanilino)piperidin-2-one |
| SMILES | Nc1c(F)cc(F)cc1NC1CCCNC1=O |
| InChI | InChI=1S/C11H13F2N3O/c12-6-4-7(13)10(14)9(5-6)16-8-2-1-3-15-11(8)17/h4-5,8,16H,1-3,14H2,(H,15,17) |
| InChIKey | WZWHUNTZNKZQSM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-3,5-difluoroanilino)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-3,5-difluoroanilino)piperidin-2-one?
The IUPAC name of 3-(2-amino-3,5-difluoroanilino)piperidin-2-one (CID 113325264) is 3-(2-amino-3,5-difluoroanilino)piperidin-2-one.
What is the SMILES notation for 3-(2-amino-3,5-difluoroanilino)piperidin-2-one?
The canonical SMILES for 3-(2-amino-3,5-difluoroanilino)piperidin-2-one is Nc1c(F)cc(F)cc1NC1CCCNC1=O.
What is the InChIKey of 3-(2-amino-3,5-difluoroanilino)piperidin-2-one?
The InChIKey is WZWHUNTZNKZQSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2N3O/c12-6-4-7(13)10(14)9(5-6)16-8-2-1-3-15-11(8)17/h4-5,8,16H,1-3,14H2,(H,15,17).
What are the key properties of 3-(2-amino-3,5-difluoroanilino)piperidin-2-one?
3-(2-amino-3,5-difluoroanilino)piperidin-2-one has a molecular weight of 241.24 g/mol, XLogP of 1.24, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-3,5-difluoroanilino)piperidin-2-one is sourced from PubChem (CID 113325264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).