About 3-(2-bromo-4,6-difluoroanilino)azepan-2-one
3-(2-bromo-4,6-difluoroanilino)azepan-2-one (PubChem CID 43168313) has the molecular formula C12H13BrF2N2O
and a molecular weight of 319.15 g/mol. Its IUPAC name is 3-(2-bromo-4,6-difluoroanilino)azepan-2-one.
Molecular Properties
| Compound Name | 3-(2-bromo-4,6-difluoroanilino)azepan-2-one |
| PubChem CID | 43168313 |
| Molecular Formula | C12H13BrF2N2O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 3-(2-bromo-4,6-difluoroanilino)azepan-2-one |
| SMILES | O=C1NCCCCC1Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C12H13BrF2N2O/c13-8-5-7(14)6-9(15)11(8)17-10-3-1-2-4-16-12(10)18/h5-6,10,17H,1-4H2,(H,16,18) |
| InChIKey | GGPGDHVJKVGZGA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-bromo-4,6-difluoroanilino)azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromo-4,6-difluoroanilino)azepan-2-one?
The IUPAC name of 3-(2-bromo-4,6-difluoroanilino)azepan-2-one (CID 43168313) is 3-(2-bromo-4,6-difluoroanilino)azepan-2-one.
What is the SMILES notation for 3-(2-bromo-4,6-difluoroanilino)azepan-2-one?
The canonical SMILES for 3-(2-bromo-4,6-difluoroanilino)azepan-2-one is O=C1NCCCCC1Nc1c(F)cc(F)cc1Br.
What is the InChIKey of 3-(2-bromo-4,6-difluoroanilino)azepan-2-one?
The InChIKey is GGPGDHVJKVGZGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrF2N2O/c13-8-5-7(14)6-9(15)11(8)17-10-3-1-2-4-16-12(10)18/h5-6,10,17H,1-4H2,(H,16,18).
What are the key properties of 3-(2-bromo-4,6-difluoroanilino)azepan-2-one?
3-(2-bromo-4,6-difluoroanilino)azepan-2-one has a molecular weight of 319.15 g/mol, XLogP of 2.81, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromo-4,6-difluoroanilino)azepan-2-one is sourced from PubChem (CID 43168313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).