C11H13F3N4O — CID 106747635
3-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]piperidin-2-one (PubChem CID 106747635) has the molecular formula C11H13F3N4O and a molecular weight of 274.25 g/mol. Its IUPAC name is 3-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]piperidin-2-one.
| Compound Name | 3-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]piperidin-2-one |
|---|---|
| PubChem CID | 106747635 |
| Molecular Formula | C11H13F3N4O |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]piperidin-2-one |
| SMILES | Nc1cnc(C(F)(F)F)cc1NC1CCCNC1=O |
| InChI | InChI=1S/C11H13F3N4O/c12-11(13,14)9-4-8(6(15)5-17-9)18-7-2-1-3-16-10(7)19/h4-5,7H,1-3,15H2,(H,16,19)(H,17,18) |
| InChIKey | BAKGAIILTUDKFT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |