C14H14ClF2N3O2 — CID 167425959
3-[[2-chloro-5-[1-(difluoromethyl)pyrazol-3-yl]-4-pyridinyl]oxy]cyclopentan-1-ol (PubChem CID 167425959) has the molecular formula C14H14ClF2N3O2 and a molecular weight of 329.73 g/mol. Its IUPAC name is 3-[[2-chloro-5-[1-(difluoromethyl)pyrazol-3-yl]-4-pyridinyl]oxy]cyclopentan-1-ol.
| Compound Name | 3-[[2-chloro-5-[1-(difluoromethyl)pyrazol-3-yl]-4-pyridinyl]oxy]cyclopentan-1-ol |
|---|---|
| PubChem CID | 167425959 |
| Molecular Formula | C14H14ClF2N3O2 |
| Molecular Weight | 329.73 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 3-[[2-chloro-5-[1-(difluoromethyl)pyrazol-3-yl]-4-pyridinyl]oxy]cyclopentan-1-ol |
| SMILES | OC1CCC(Oc2cc(Cl)ncc2-c2ccn(C(F)F)n2)C1 |
| InChI | InChI=1S/C14H14ClF2N3O2/c15-13-6-12(22-9-2-1-8(21)5-9)10(7-18-13)11-3-4-20(19-11)14(16)17/h3-4,6-9,14,21H,1-2,5H2 |
| InChIKey | SDAQYNZNTDSROJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.73 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|