C18H25ClN4O — CID 167425639
4-[[2-chloro-5-(1-propan-2-ylpyrazol-3-yl)-4-pyridinyl]amino]-1-methylcyclohexan-1-ol (PubChem CID 167425639) has the molecular formula C18H25ClN4O and a molecular weight of 348.88 g/mol. Its IUPAC name is 4-[[2-chloro-5-(1-propan-2-ylpyrazol-3-yl)-4-pyridinyl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[2-chloro-5-(1-propan-2-ylpyrazol-3-yl)-4-pyridinyl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 167425639 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 4-[[2-chloro-5-(1-propan-2-ylpyrazol-3-yl)-4-pyridinyl]amino]-1-methylcyclohexan-1-ol |
| SMILES | CC(C)n1ccc(-c2cnc(Cl)cc2NC2CCC(C)(O)CC2)n1 |
| InChI | InChI=1S/C18H25ClN4O/c1-12(2)23-9-6-15(22-23)14-11-20-17(19)10-16(14)21-13-4-7-18(3,24)8-5-13/h6,9-13,24H,4-5,7-8H2,1-3H3,(H,20,21) |
| InChIKey | LWKDTEHXWQNIJE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|