C21H27ClN4O4S — CID 171572466
4-[[2-chloro-5-(5-morpholin-4-ylsulfonyl-2-pyridinyl)-4-pyridinyl]amino]-1-methylcyclohexan-1-ol (PubChem CID 171572466) has the molecular formula C21H27ClN4O4S and a molecular weight of 466.99 g/mol. Its IUPAC name is 4-[[2-chloro-5-(5-morpholin-4-ylsulfonyl-2-pyridinyl)-4-pyridinyl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[2-chloro-5-(5-morpholin-4-ylsulfonyl-2-pyridinyl)-4-pyridinyl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 171572466 |
| Molecular Formula | C21H27ClN4O4S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 4-[[2-chloro-5-(5-morpholin-4-ylsulfonyl-2-pyridinyl)-4-pyridinyl]amino]-1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCC(Nc2cc(Cl)ncc2-c2ccc(S(=O)(=O)N3CCOCC3)cn2)CC1 |
| InChI | InChI=1S/C21H27ClN4O4S/c1-21(27)6-4-15(5-7-21)25-19-12-20(22)24-14-17(19)18-3-2-16(13-23-18)31(28,29)26-8-10-30-11-9-26/h2-3,12-15,27H,4-11H2,1H3,(H,24,25) |
| InChIKey | NTUAKJCGGFXLCC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|