C16H19ClF2N4O — CID 167425812
4-[[2-chloro-5-[3-(difluoromethyl)pyrazol-1-yl]-4-pyridinyl]amino]-1-methylcyclohexan-1-ol (PubChem CID 167425812) has the molecular formula C16H19ClF2N4O and a molecular weight of 356.80 g/mol. Its IUPAC name is 4-[[2-chloro-5-[3-(difluoromethyl)pyrazol-1-yl]-4-pyridinyl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[2-chloro-5-[3-(difluoromethyl)pyrazol-1-yl]-4-pyridinyl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 167425812 |
| Molecular Formula | C16H19ClF2N4O |
| Molecular Weight | 356.80 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 4-[[2-chloro-5-[3-(difluoromethyl)pyrazol-1-yl]-4-pyridinyl]amino]-1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCC(Nc2cc(Cl)ncc2-n2ccc(C(F)F)n2)CC1 |
| InChI | InChI=1S/C16H19ClF2N4O/c1-16(24)5-2-10(3-6-16)21-12-8-14(17)20-9-13(12)23-7-4-11(22-23)15(18)19/h4,7-10,15,24H,2-3,5-6H2,1H3,(H,20,21) |
| InChIKey | XJLNIBSBWDGLKU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.80 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|