C18H21ClF2N4O2 — CID 146423212
ethyl 6-chloro-4-[[4-[3-(difluoromethyl)pyrazol-1-yl]cyclohexyl]amino]pyridine-3-carboxylate (PubChem CID 146423212) has the molecular formula C18H21ClF2N4O2 and a molecular weight of 398.84 g/mol. Its IUPAC name is ethyl 6-chloro-4-[[4-[3-(difluoromethyl)pyrazol-1-yl]cyclohexyl]amino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-[[4-[3-(difluoromethyl)pyrazol-1-yl]cyclohexyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 146423212 |
| Molecular Formula | C18H21ClF2N4O2 |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | ethyl 6-chloro-4-[[4-[3-(difluoromethyl)pyrazol-1-yl]cyclohexyl]amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)cc1NC1CCC(n2ccc(C(F)F)n2)CC1 |
| InChI | InChI=1S/C18H21ClF2N4O2/c1-2-27-18(26)13-10-22-16(19)9-15(13)23-11-3-5-12(6-4-11)25-8-7-14(24-25)17(20)21/h7-12,17H,2-6H2,1H3,(H,22,23) |
| InChIKey | QGDRGARGTJANIB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|