C20H27ClN4O2 — CID 171572584
4-[[2-chloro-5-[4-(3-hydroxypropylamino)-2-pyridinyl]-4-pyridinyl]amino]-1-methylcyclohexan-1-ol (PubChem CID 171572584) has the molecular formula C20H27ClN4O2 and a molecular weight of 390.92 g/mol. Its IUPAC name is 4-[[2-chloro-5-[4-(3-hydroxypropylamino)-2-pyridinyl]-4-pyridinyl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[2-chloro-5-[4-(3-hydroxypropylamino)-2-pyridinyl]-4-pyridinyl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 171572584 |
| Molecular Formula | C20H27ClN4O2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4-[[2-chloro-5-[4-(3-hydroxypropylamino)-2-pyridinyl]-4-pyridinyl]amino]-1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCC(Nc2cc(Cl)ncc2-c2cc(NCCCO)ccn2)CC1 |
| InChI | InChI=1S/C20H27ClN4O2/c1-20(27)6-3-14(4-7-20)25-18-12-19(21)24-13-16(18)17-11-15(5-9-23-17)22-8-2-10-26/h5,9,11-14,26-27H,2-4,6-8,10H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | XUOCFEPDAFMDDW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|