C17H23ClFN5 — CID 175837930
4-N-[2-chloro-5-(1-methylpyrazol-3-yl)-4-pyridinyl]-1-N-(2-fluoroethyl)cyclohexane-1,4-diamine (PubChem CID 175837930) has the molecular formula C17H23ClFN5 and a molecular weight of 351.86 g/mol. Its IUPAC name is 4-N-[2-chloro-5-(1-methylpyrazol-3-yl)-4-pyridinyl]-1-N-(2-fluoroethyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-[2-chloro-5-(1-methylpyrazol-3-yl)-4-pyridinyl]-1-N-(2-fluoroethyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 175837930 |
| Molecular Formula | C17H23ClFN5 |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-N-[2-chloro-5-(1-methylpyrazol-3-yl)-4-pyridinyl]-1-N-(2-fluoroethyl)cyclohexane-1,4-diamine |
| SMILES | Cn1ccc(-c2cnc(Cl)cc2NC2CCC(NCCF)CC2)n1 |
| InChI | InChI=1S/C17H23ClFN5/c1-24-9-6-15(23-24)14-11-21-17(18)10-16(14)22-13-4-2-12(3-5-13)20-8-7-19/h6,9-13,20H,2-5,7-8H2,1H3,(H,21,22) |
| InChIKey | VKWNTUMLVAVYTR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|