C21H26ClF2N5O — CID 167426462
[4-[[2-chloro-5-[5-(4,4-difluoropiperidin-1-yl)pyrazin-2-yl]-4-pyridinyl]amino]cyclohexyl]methanol (PubChem CID 167426462) has the molecular formula C21H26ClF2N5O and a molecular weight of 437.92 g/mol. Its IUPAC name is [4-[[2-chloro-5-[5-(4,4-difluoropiperidin-1-yl)pyrazin-2-yl]-4-pyridinyl]amino]cyclohexyl]methanol.
| Compound Name | [4-[[2-chloro-5-[5-(4,4-difluoropiperidin-1-yl)pyrazin-2-yl]-4-pyridinyl]amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 167426462 |
| Molecular Formula | C21H26ClF2N5O |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | [4-[[2-chloro-5-[5-(4,4-difluoropiperidin-1-yl)pyrazin-2-yl]-4-pyridinyl]amino]cyclohexyl]methanol |
| SMILES | OCC1CCC(Nc2cc(Cl)ncc2-c2cnc(N3CCC(F)(F)CC3)cn2)CC1 |
| InChI | InChI=1S/C21H26ClF2N5O/c22-19-9-17(28-15-3-1-14(13-30)2-4-15)16(10-26-19)18-11-27-20(12-25-18)29-7-5-21(23,24)6-8-29/h9-12,14-15,30H,1-8,13H2,(H,26,28) |
| InChIKey | OESFJVHYGIXEQI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|