C14H14ClF2N3O — CID 168932056
[7-chloro-1-(4,4-difluoropiperidin-1-yl)-2,6-naphthyridin-3-yl]methanol (PubChem CID 168932056) has the molecular formula C14H14ClF2N3O and a molecular weight of 313.74 g/mol. Its IUPAC name is [7-chloro-1-(4,4-difluoropiperidin-1-yl)-2,6-naphthyridin-3-yl]methanol.
| Compound Name | [7-chloro-1-(4,4-difluoropiperidin-1-yl)-2,6-naphthyridin-3-yl]methanol |
|---|---|
| PubChem CID | 168932056 |
| Molecular Formula | C14H14ClF2N3O |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | [7-chloro-1-(4,4-difluoropiperidin-1-yl)-2,6-naphthyridin-3-yl]methanol |
| SMILES | OCc1cc2cnc(Cl)cc2c(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C14H14ClF2N3O/c15-12-6-11-9(7-18-12)5-10(8-21)19-13(11)20-3-1-14(16,17)2-4-20/h5-7,21H,1-4,8H2 |
| InChIKey | OXFUFDFFLQMUJF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|