C10H11ClF2N2 — CID 121204880
2-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine (PubChem CID 121204880) has the molecular formula C10H11ClF2N2 and a molecular weight of 232.66 g/mol. Its IUPAC name is 2-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine.
| Compound Name | 2-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 121204880 |
| Molecular Formula | C10H11ClF2N2 |
| Molecular Weight | 232.66 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 2-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine |
| SMILES | FC1(F)CCN(c2ccnc(Cl)c2)CC1 |
| InChI | InChI=1S/C10H11ClF2N2/c11-9-7-8(1-4-14-9)15-5-2-10(12,13)3-6-15/h1,4,7H,2-3,5-6H2 |
| InChIKey | RWDDDURBOCZMJU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.66 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|