C12H12ClF2NO2 — CID 155908730
2-chloro-4-(4,4-difluoropiperidin-1-yl)benzoic acid (PubChem CID 155908730) has the molecular formula C12H12ClF2NO2 and a molecular weight of 275.68 g/mol. Its IUPAC name is 2-chloro-4-(4,4-difluoropiperidin-1-yl)benzoic acid.
| Compound Name | 2-chloro-4-(4,4-difluoropiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 155908730 |
| Molecular Formula | C12H12ClF2NO2 |
| Molecular Weight | 275.68 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-chloro-4-(4,4-difluoropiperidin-1-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCC(F)(F)CC2)cc1Cl |
| InChI | InChI=1S/C12H12ClF2NO2/c13-10-7-8(1-2-9(10)11(17)18)16-5-3-12(14,15)4-6-16/h1-2,7H,3-6H2,(H,17,18) |
| InChIKey | AKQISLKYDOYLPR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.68 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |