C10H9ClF3N — CID 117007618
1-(3-chloro-4-fluorophenyl)-3,3-difluoropyrrolidine (PubChem CID 117007618) has the molecular formula C10H9ClF3N and a molecular weight of 235.64 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3,3-difluoropyrrolidine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3,3-difluoropyrrolidine |
|---|---|
| PubChem CID | 117007618 |
| Molecular Formula | C10H9ClF3N |
| Molecular Weight | 235.64 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3,3-difluoropyrrolidine |
| SMILES | Fc1ccc(N2CCC(F)(F)C2)cc1Cl |
| InChI | InChI=1S/C10H9ClF3N/c11-8-5-7(1-2-9(8)12)15-4-3-10(13,14)6-15/h1-2,5H,3-4,6H2 |
| InChIKey | TZSHJAGHQNUPML-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.64 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |