C12H16F2N2 — CID 169489232
[4-(3,3-difluoropyrrolidin-1-yl)-2-methylphenyl]methanamine (PubChem CID 169489232) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is [4-(3,3-difluoropyrrolidin-1-yl)-2-methylphenyl]methanamine.
| Compound Name | [4-(3,3-difluoropyrrolidin-1-yl)-2-methylphenyl]methanamine |
|---|---|
| PubChem CID | 169489232 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | [4-(3,3-difluoropyrrolidin-1-yl)-2-methylphenyl]methanamine |
| SMILES | Cc1cc(N2CCC(F)(F)C2)ccc1CN |
| InChI | InChI=1S/C12H16F2N2/c1-9-6-11(3-2-10(9)7-15)16-5-4-12(13,14)8-16/h2-3,6H,4-5,7-8,15H2,1H3 |
| InChIKey | UZXJXIBBEARREA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|