C11H11Cl2F2N — CID 117007805
1-(3,4-dichlorophenyl)-4,4-difluoropiperidine (PubChem CID 117007805) has the molecular formula C11H11Cl2F2N and a molecular weight of 266.12 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4,4-difluoropiperidine.
| Compound Name | 1-(3,4-dichlorophenyl)-4,4-difluoropiperidine |
|---|---|
| PubChem CID | 117007805 |
| Molecular Formula | C11H11Cl2F2N |
| Molecular Weight | 266.12 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4,4-difluoropiperidine |
| SMILES | FC1(F)CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C11H11Cl2F2N/c12-9-2-1-8(7-10(9)13)16-5-3-11(14,15)4-6-16/h1-2,7H,3-6H2 |
| InChIKey | UWFMOIIKDFDZRE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.12 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |