C14H21F2N — CID 145061539
4,4-difluoro-1-(4-methylphenyl)piperidine;ethane (PubChem CID 145061539) has the molecular formula C14H21F2N and a molecular weight of 241.33 g/mol. Its IUPAC name is 4,4-difluoro-1-(4-methylphenyl)piperidine;ethane.
| Compound Name | 4,4-difluoro-1-(4-methylphenyl)piperidine;ethane |
|---|---|
| PubChem CID | 145061539 |
| Molecular Formula | C14H21F2N |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4,4-difluoro-1-(4-methylphenyl)piperidine;ethane |
| SMILES | CC.Cc1ccc(N2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C12H15F2N.C2H6/c1-10-2-4-11(5-3-10)15-8-6-12(13,14)7-9-15;1-2/h2-5H,6-9H2,1H3;1-2H3 |
| InChIKey | VDSDIKVFVIXUEG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|