C11H12F2IN — CID 166883547
4,4-difluoro-1-(4-iodophenyl)piperidine (PubChem CID 166883547) has the molecular formula C11H12F2IN and a molecular weight of 323.12 g/mol. Its IUPAC name is 4,4-difluoro-1-(4-iodophenyl)piperidine.
| Compound Name | 4,4-difluoro-1-(4-iodophenyl)piperidine |
|---|---|
| PubChem CID | 166883547 |
| Molecular Formula | C11H12F2IN |
| Molecular Weight | 323.12 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 4,4-difluoro-1-(4-iodophenyl)piperidine |
| SMILES | FC1(F)CCN(c2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C11H12F2IN/c12-11(13)5-7-15(8-6-11)10-3-1-9(14)2-4-10/h1-4H,5-8H2 |
| InChIKey | ZHCXJJYAZHCUFD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.12 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|