C16H23F2N3 — CID 163230338
1-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-methylpiperazine (PubChem CID 163230338) has the molecular formula C16H23F2N3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-methylpiperazine.
| Compound Name | 1-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 163230338 |
| Molecular Formula | C16H23F2N3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-methylpiperazine |
| SMILES | CN1CCN(c2cccc(N3CCC(F)(F)CC3)c2)CC1 |
| InChI | InChI=1S/C16H23F2N3/c1-19-9-11-21(12-10-19)15-4-2-3-14(13-15)20-7-5-16(17,18)6-8-20/h2-4,13H,5-12H2,1H3 |
| InChIKey | IASJWDAYWAVVTQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |