C13H23NO2S — CID 144607446
1,1-dihydroxy-4-(4-methylphenyl)-1,4-thiazinane;ethane (PubChem CID 144607446) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 1,1-dihydroxy-4-(4-methylphenyl)-1,4-thiazinane;ethane.
| Compound Name | 1,1-dihydroxy-4-(4-methylphenyl)-1,4-thiazinane;ethane |
|---|---|
| PubChem CID | 144607446 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1,1-dihydroxy-4-(4-methylphenyl)-1,4-thiazinane;ethane |
| SMILES | CC.Cc1ccc(N2CCS(O)(O)CC2)cc1 |
| InChI | InChI=1S/C11H17NO2S.C2H6/c1-10-2-4-11(5-3-10)12-6-8-15(13,14)9-7-12;1-2/h2-5,13-14H,6-9H2,1H3;1-2H3 |
| InChIKey | AEZVAAYFEHNEJL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|