C18H22N2 — CID 22020050
1,3-bis(4-methylphenyl)-1,3-diazinane (PubChem CID 22020050) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 1,3-bis(4-methylphenyl)-1,3-diazinane.
| Compound Name | 1,3-bis(4-methylphenyl)-1,3-diazinane |
|---|---|
| PubChem CID | 22020050 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1,3-bis(4-methylphenyl)-1,3-diazinane |
| SMILES | Cc1ccc(N2CCCN(c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C18H22N2/c1-15-4-8-17(9-5-15)19-12-3-13-20(14-19)18-10-6-16(2)7-11-18/h4-11H,3,12-14H2,1-2H3 |
| InChIKey | UAKWGJLCGBZMPO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|