C16H28N2 — CID 177351014
ethane;1-ethyl-4-(4-methylphenyl)-1,4-diazepane (PubChem CID 177351014) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is ethane;1-ethyl-4-(4-methylphenyl)-1,4-diazepane.
| Compound Name | ethane;1-ethyl-4-(4-methylphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 177351014 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | ethane;1-ethyl-4-(4-methylphenyl)-1,4-diazepane |
| SMILES | CC.CCN1CCCN(c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C14H22N2.C2H6/c1-3-15-9-4-10-16(12-11-15)14-7-5-13(2)6-8-14;1-2/h5-8H,3-4,9-12H2,1-2H3;1-2H3 |
| InChIKey | JCHQIGYIFSKIBL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|