C30H48N2 — CID 167661867
1,4-dimethylcyclohexane;1-ethyl-4-(4-ethylphenyl)piperazine;1,4-xylene (PubChem CID 167661867) has the molecular formula C30H48N2 and a molecular weight of 436.73 g/mol. Its IUPAC name is 1,4-dimethylcyclohexane;1-ethyl-4-(4-ethylphenyl)piperazine;1,4-xylene.
| Compound Name | 1,4-dimethylcyclohexane;1-ethyl-4-(4-ethylphenyl)piperazine;1,4-xylene |
|---|---|
| PubChem CID | 167661867 |
| Molecular Formula | C30H48N2 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 436.38 |
| IUPAC Name | 1,4-dimethylcyclohexane;1-ethyl-4-(4-ethylphenyl)piperazine;1,4-xylene |
| SMILES | CC1CCC(C)CC1.CCc1ccc(N2CCN(CC)CC2)cc1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C14H22N2.C8H16.C8H10/c1-3-13-5-7-14(8-6-13)16-11-9-15(4-2)10-12-16;2*1-7-3-5-8(2)6-4-7/h5-8H,3-4,9-12H2,1-2H3;7-8H,3-6H2,1-2H3;3-6H,1-2H3 |
| InChIKey | SBLDYPOQMGSZNC-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|