C43H75N5 — CID 167649681
bis(1-ethyl-4-methylpiperidine);1-(4-ethylphenyl)-4-methylpiperazine;4-(4-ethylphenyl)-1-methylpiperidine (PubChem CID 167649681) has the molecular formula C43H75N5 and a molecular weight of 662.11 g/mol. Its IUPAC name is bis(1-ethyl-4-methylpiperidine);1-(4-ethylphenyl)-4-methylpiperazine;4-(4-ethylphenyl)-1-methylpiperidine.
| Compound Name | bis(1-ethyl-4-methylpiperidine);1-(4-ethylphenyl)-4-methylpiperazine;4-(4-ethylphenyl)-1-methylpiperidine |
|---|---|
| PubChem CID | 167649681 |
| Molecular Formula | C43H75N5 |
| Molecular Weight | 662.11 g/mol |
| Exact Mass | 661.60 |
| IUPAC Name | bis(1-ethyl-4-methylpiperidine);1-(4-ethylphenyl)-4-methylpiperazine;4-(4-ethylphenyl)-1-methylpiperidine |
| SMILES | CCN1CCC(C)CC1.CCN1CCC(C)CC1.CCc1ccc(C2CCN(C)CC2)cc1.CCc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C14H21N.C13H20N2.2C8H17N/c1-3-12-4-6-13(7-5-12)14-8-10-15(2)11-9-14;1-3-12-4-6-13(7-5-12)15-10-8-14(2)9-11-15;2*1-3-9-6-4-8(2)5-7-9/h4-7,14H,3,8-11H2,1-2H3;4-7H,3,8-11H2,1-2H3;2*8H,3-7H2,1-2H3 |
| InChIKey | QJUMUIVCGLGIHK-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 16.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.11 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|