C32H52N4 — CID 167698889
1,4-dimethylpiperidine;1-methyl-4-(4-methylphenyl)piperazine;1-methyl-4-(4-methylphenyl)piperidine (PubChem CID 167698889) has the molecular formula C32H52N4 and a molecular weight of 492.80 g/mol. Its IUPAC name is 1,4-dimethylpiperidine;1-methyl-4-(4-methylphenyl)piperazine;1-methyl-4-(4-methylphenyl)piperidine.
| Compound Name | 1,4-dimethylpiperidine;1-methyl-4-(4-methylphenyl)piperazine;1-methyl-4-(4-methylphenyl)piperidine |
|---|---|
| PubChem CID | 167698889 |
| Molecular Formula | C32H52N4 |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.42 |
| IUPAC Name | 1,4-dimethylpiperidine;1-methyl-4-(4-methylphenyl)piperazine;1-methyl-4-(4-methylphenyl)piperidine |
| SMILES | CC1CCN(C)CC1.Cc1ccc(C2CCN(C)CC2)cc1.Cc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C13H19N.C12H18N2.C7H15N/c1-11-3-5-12(6-4-11)13-7-9-14(2)10-8-13;1-11-3-5-12(6-4-11)14-9-7-13(2)8-10-14;1-7-3-5-8(2)6-4-7/h3-6,13H,7-10H2,1-2H3;3-6H,7-10H2,1-2H3;7H,3-6H2,1-2H3 |
| InChIKey | YBPRVMJFNLXBOS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|