C41H61N5 — CID 91560179
1,2-dimethyl-4-(4-methylphenyl)piperazine;1-methyl-4-(4-methylphenyl)piperidine;2-(4-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 91560179) has the molecular formula C41H61N5 and a molecular weight of 623.97 g/mol. Its IUPAC name is 1,2-dimethyl-4-(4-methylphenyl)piperazine;1-methyl-4-(4-methylphenyl)piperidine;2-(4-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 1,2-dimethyl-4-(4-methylphenyl)piperazine;1-methyl-4-(4-methylphenyl)piperidine;2-(4-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 91560179 |
| Molecular Formula | C41H61N5 |
| Molecular Weight | 623.97 g/mol |
| Exact Mass | 623.49 |
| IUPAC Name | 1,2-dimethyl-4-(4-methylphenyl)piperazine;1-methyl-4-(4-methylphenyl)piperidine;2-(4-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | Cc1ccc(C2CCN(C)CC2)cc1.Cc1ccc(N2CCN(C)C(C)C2)cc1.Cc1ccc(N2CCN3CCCCC3C2)cc1 |
| InChI | InChI=1S/C15H22N2.C13H20N2.C13H19N/c1-13-5-7-14(8-6-13)17-11-10-16-9-3-2-4-15(16)12-17;1-11-4-6-13(7-5-11)15-9-8-14(3)12(2)10-15;1-11-3-5-12(6-4-11)13-7-9-14(2)10-8-13/h5-8,15H,2-4,9-12H2,1H3;4-7,12H,8-10H2,1-3H3;3-6,13H,7-10H2,1-2H3 |
| InChIKey | ZUDHXXGIEJJEAF-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 16.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.97 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|