C15H22N2 — CID 163257013
2-methyl-7-(4-methylphenyl)-2,7-diazaspiro[3.5]nonane (PubChem CID 163257013) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 2-methyl-7-(4-methylphenyl)-2,7-diazaspiro[3.5]nonane.
| Compound Name | 2-methyl-7-(4-methylphenyl)-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 163257013 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-methyl-7-(4-methylphenyl)-2,7-diazaspiro[3.5]nonane |
| SMILES | Cc1ccc(N2CCC3(CC2)CN(C)C3)cc1 |
| InChI | InChI=1S/C15H22N2/c1-13-3-5-14(6-4-13)17-9-7-15(8-10-17)11-16(2)12-15/h3-6H,7-12H2,1-2H3 |
| InChIKey | WNZNOUVJHDXKTG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|