C11H12ClF2N — CID 117007615
1-(5-chloro-2-methylphenyl)-3,3-difluoropyrrolidine (PubChem CID 117007615) has the molecular formula C11H12ClF2N and a molecular weight of 231.67 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-3,3-difluoropyrrolidine.
| Compound Name | 1-(5-chloro-2-methylphenyl)-3,3-difluoropyrrolidine |
|---|---|
| PubChem CID | 117007615 |
| Molecular Formula | C11H12ClF2N |
| Molecular Weight | 231.67 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-3,3-difluoropyrrolidine |
| SMILES | Cc1ccc(Cl)cc1N1CCC(F)(F)C1 |
| InChI | InChI=1S/C11H12ClF2N/c1-8-2-3-9(12)6-10(8)15-5-4-11(13,14)7-15/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | PMVHFNQCMVLHBT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.67 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |