C12H17ClN2 — CID 60862449
1-(5-chloro-2-methylphenyl)-N-methylpyrrolidin-3-amine (PubChem CID 60862449) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-N-methylpyrrolidin-3-amine.
| Compound Name | 1-(5-chloro-2-methylphenyl)-N-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 60862449 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-N-methylpyrrolidin-3-amine |
| SMILES | CNC1CCN(c2cc(Cl)ccc2C)C1 |
| InChI | InChI=1S/C12H17ClN2/c1-9-3-4-10(13)7-12(9)15-6-5-11(8-15)14-2/h3-4,7,11,14H,5-6,8H2,1-2H3 |
| InChIKey | HAAZNBMYDLCZMN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |