C19H29ClN4 — CID 111094788
2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-1-cyclohexylguanidine (PubChem CID 111094788) has the molecular formula C19H29ClN4 and a molecular weight of 348.92 g/mol. Its IUPAC name is 2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-1-cyclohexylguanidine.
| Compound Name | 2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-1-cyclohexylguanidine |
|---|---|
| PubChem CID | 111094788 |
| Molecular Formula | C19H29ClN4 |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-1-cyclohexylguanidine |
| SMILES | Cc1ccc(Cl)cc1N1CCC(C/N=C(\N)NC2CCCCC2)C1 |
| InChI | InChI=1S/C19H29ClN4/c1-14-7-8-16(20)11-18(14)24-10-9-15(13-24)12-22-19(21)23-17-5-3-2-4-6-17/h7-8,11,15,17H,2-6,9-10,12-13H2,1H3,(H3,21,22,23) |
| InChIKey | PQTJUEBGNKAJSP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|