C20H32ClN5O — CID 111094808
2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-1-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111094808) has the molecular formula C20H32ClN5O and a molecular weight of 393.96 g/mol. Its IUPAC name is 2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-1-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-1-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111094808 |
| Molecular Formula | C20H32ClN5O |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-1-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | Cc1ccc(Cl)cc1N1CCC(C/N=C(\N)NCCCN2CCOCC2)C1 |
| InChI | InChI=1S/C20H32ClN5O/c1-16-3-4-18(21)13-19(16)26-8-5-17(15-26)14-24-20(22)23-6-2-7-25-9-11-27-12-10-25/h3-4,13,17H,2,5-12,14-15H2,1H3,(H3,22,23,24) |
| InChIKey | MGXHRMGDHMBYON-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|