C21H33ClN4O — CID 109381982
2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109381982) has the molecular formula C21H33ClN4O and a molecular weight of 392.98 g/mol. Its IUPAC name is 2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109381982 |
| Molecular Formula | C21H33ClN4O |
| Molecular Weight | 392.98 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CC1CCN(c2cc(Cl)ccc2C)C1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C21H33ClN4O/c1-4-23-21(25(3)13-18-8-10-27-15-18)24-12-17-7-9-26(14-17)20-11-19(22)6-5-16(20)2/h5-6,11,17-18H,4,7-10,12-15H2,1-3H3,(H,23,24) |
| InChIKey | GTWNRJNIBGLWRK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.98 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|