C22H34ClIN4O2 — CID 111255154
methyl 1-[N'-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111255154) has the molecular formula C22H34ClIN4O2 and a molecular weight of 548.90 g/mol. Its IUPAC name is methyl 1-[N'-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111255154 |
| Molecular Formula | C22H34ClIN4O2 |
| Molecular Weight | 548.90 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | methyl 1-[N'-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(c2cc(Cl)ccc2C)C1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C22H33ClN4O2.HI/c1-4-24-22(26-11-8-18(9-12-26)21(28)29-3)25-14-17-7-10-27(15-17)20-13-19(23)6-5-16(20)2;/h5-6,13,17-18H,4,7-12,14-15H2,1-3H3,(H,24,25);1H |
| InChIKey | RZGUVAKPEDYEGD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.90 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|