C17H32N4O2 — CID 111253197
methyl 1-[N-ethyl-N'-[(1-ethylpyrrolidin-3-yl)methyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111253197) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[(1-ethylpyrrolidin-3-yl)methyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-ethyl-N'-[(1-ethylpyrrolidin-3-yl)methyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111253197 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[(1-ethylpyrrolidin-3-yl)methyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CC1CCN(CC)C1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C17H32N4O2/c1-4-18-17(19-12-14-6-9-20(5-2)13-14)21-10-7-15(8-11-21)16(22)23-3/h14-15H,4-13H2,1-3H3,(H,18,19) |
| InChIKey | LCQPWUURVXCVCI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|