C22H36ClIN4O2 — CID 111747660
N-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111747660) has the molecular formula C22H36ClIN4O2 and a molecular weight of 550.91 g/mol. Its IUPAC name is N-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111747660 |
| Molecular Formula | C22H36ClIN4O2 |
| Molecular Weight | 550.91 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | N-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCC1CCN(c2cc(Cl)ccc2C)C1)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C22H35ClN4O2.HI/c1-17-4-5-20(23)12-21(17)26-8-6-18(14-26)13-25-22(24-2)27-9-7-19(15-27)16-29-11-10-28-3;/h4-5,12,18-19H,6-11,13-16H2,1-3H3,(H,24,25);1H |
| InChIKey | NJTFSBMEBPCRIV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.91 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|