C15H24ClIN4 — CID 110927871
1-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-2,3-dimethylguanidine;hydroiodide (PubChem CID 110927871) has the molecular formula C15H24ClIN4 and a molecular weight of 422.74 g/mol. Its IUPAC name is 1-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-2,3-dimethylguanidine;hydroiodide.
| Compound Name | 1-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-2,3-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110927871 |
| Molecular Formula | C15H24ClIN4 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 1-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-2,3-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCC1CCN(c2cc(Cl)ccc2C)C1.I |
| InChI | InChI=1S/C15H23ClN4.HI/c1-11-4-5-13(16)8-14(11)20-7-6-12(10-20)9-19-15(17-2)18-3;/h4-5,8,12H,6-7,9-10H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | JOSCEVIHQUEIQO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|