C22H32ClN5O — CID 111595468
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine (PubChem CID 111595468) has the molecular formula C22H32ClN5O and a molecular weight of 417.99 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111595468 |
| Molecular Formula | C22H32ClN5O |
| Molecular Weight | 417.99 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)NCC1CCN(c2cc(Cl)ccc2C)C1 |
| InChI | InChI=1S/C22H32ClN5O/c1-15-6-7-17(23)10-18(15)28-9-8-16(14-28)11-26-21(24-5)27-13-20-25-12-19(29-20)22(2,3)4/h6-7,10,12,16H,8-9,11,13-14H2,1-5H3,(H2,24,26,27) |
| InChIKey | SYPWEXUYOBFAON-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.99 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|