C18H23ClF2N4O2 — CID 111991405
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine (PubChem CID 111991405) has the molecular formula C18H23ClF2N4O2 and a molecular weight of 400.86 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111991405 |
| Molecular Formula | C18H23ClF2N4O2 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)NCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C18H23ClF2N4O2/c1-18(2,3)14-9-23-15(27-14)10-25-17(22-4)24-8-11-7-12(19)5-6-13(11)26-16(20)21/h5-7,9,16H,8,10H2,1-4H3,(H2,22,24,25) |
| InChIKey | PTKQSHINYPPVGQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|