C17H22ClF2IN4OS — CID 111985510
1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111985510) has the molecular formula C17H22ClF2IN4OS and a molecular weight of 530.81 g/mol. Its IUPAC name is 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111985510 |
| Molecular Formula | C17H22ClF2IN4OS |
| Molecular Weight | 530.81 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CCN/C(=N\C)NCc2cc(Cl)ccc2OC(F)F)s1.I |
| InChI | InChI=1S/C17H21ClF2N4OS.HI/c1-3-13-10-23-15(26-13)6-7-22-17(21-2)24-9-11-8-12(18)4-5-14(11)25-16(19)20;/h4-5,8,10,16H,3,6-7,9H2,1-2H3,(H2,21,22,24);1H |
| InChIKey | CWNIXBJVMPUMNG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.81 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|