C16H20Cl2N4S — CID 111512134
1-[(2,4-dichlorophenyl)methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine (PubChem CID 111512134) has the molecular formula C16H20Cl2N4S and a molecular weight of 371.34 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111512134 |
| Molecular Formula | C16H20Cl2N4S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine |
| SMILES | CCc1cnc(CCN/C(=N\C)NCc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C16H20Cl2N4S/c1-3-13-10-21-15(23-13)6-7-20-16(19-2)22-9-11-4-5-12(17)8-14(11)18/h4-5,8,10H,3,6-7,9H2,1-2H3,(H2,19,20,22) |
| InChIKey | LRPVKNUGEZTRAO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|