C23H36N6S — CID 111531549
1-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine (PubChem CID 111531549) has the molecular formula C23H36N6S and a molecular weight of 428.65 g/mol. Its IUPAC name is 1-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111531549 |
| Molecular Formula | C23H36N6S |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 1-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine |
| SMILES | CCc1cnc(CCN/C(=N\C)NCc2ccccc2CN2CCN(CC)CC2)s1 |
| InChI | InChI=1S/C23H36N6S/c1-4-21-17-26-22(30-21)10-11-25-23(24-3)27-16-19-8-6-7-9-20(19)18-29-14-12-28(5-2)13-15-29/h6-9,17H,4-5,10-16,18H2,1-3H3,(H2,24,25,27) |
| InChIKey | XGMIAATXYAMCDE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|