C18H28IN5O2S — CID 111531926
1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111531926) has the molecular formula C18H28IN5O2S and a molecular weight of 505.43 g/mol. Its IUPAC name is 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111531926 |
| Molecular Formula | C18H28IN5O2S |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CCN/C(=N\C)NCc2cccnc2OCCOC)s1.I |
| InChI | InChI=1S/C18H27N5O2S.HI/c1-4-15-13-22-16(26-15)7-9-21-18(19-2)23-12-14-6-5-8-20-17(14)25-11-10-24-3;/h5-6,8,13H,4,7,9-12H2,1-3H3,(H2,19,21,23);1H |
| InChIKey | UCAHGYXCFJBMJD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|