C18H27IN4O2S — CID 111957788
1-[(5-ethylthiophen-2-yl)methyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111957788) has the molecular formula C18H27IN4O2S and a molecular weight of 490.41 g/mol. Its IUPAC name is 1-[(5-ethylthiophen-2-yl)methyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-ethylthiophen-2-yl)methyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111957788 |
| Molecular Formula | C18H27IN4O2S |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 1-[(5-ethylthiophen-2-yl)methyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1ccc(CN/C(=N\C)NCc2cccnc2OCCOC)s1.I |
| InChI | InChI=1S/C18H26N4O2S.HI/c1-4-15-7-8-16(25-15)13-22-18(19-2)21-12-14-6-5-9-20-17(14)24-11-10-23-3;/h5-9H,4,10-13H2,1-3H3,(H2,19,21,22);1H |
| InChIKey | BOJPVEPYGUVVKV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|