C16H29IN4O3 — CID 111406190
1-[(2-ethoxy-3-pyridinyl)methyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111406190) has the molecular formula C16H29IN4O3 and a molecular weight of 452.34 g/mol. Its IUPAC name is 1-[(2-ethoxy-3-pyridinyl)methyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2-ethoxy-3-pyridinyl)methyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111406190 |
| Molecular Formula | C16H29IN4O3 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 1-[(2-ethoxy-3-pyridinyl)methyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOc1ncccc1CN/C(=N/C)NCCCOCCOC.I |
| InChI | InChI=1S/C16H28N4O3.HI/c1-4-23-15-14(7-5-8-18-15)13-20-16(17-2)19-9-6-10-22-12-11-21-3;/h5,7-8H,4,6,9-13H2,1-3H3,(H2,17,19,20);1H |
| InChIKey | YWKFBRYJUQRWNQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|