C23H34N4O4 — CID 111404623
1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111404623) has the molecular formula C23H34N4O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111404623 |
| Molecular Formula | C23H34N4O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | CCCOc1ccc(Oc2ncccc2CN/C(=N/C)NCCCOCCOC)cc1 |
| InChI | InChI=1S/C23H34N4O4/c1-4-14-30-20-8-10-21(11-9-20)31-22-19(7-5-12-25-22)18-27-23(24-2)26-13-6-15-29-17-16-28-3/h5,7-12H,4,6,13-18H2,1-3H3,(H2,24,26,27) |
| InChIKey | CVMOWOGNERNQSE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|