C23H32ClN7 — CID 111207990
N'-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111207990) has the molecular formula C23H32ClN7 and a molecular weight of 442.01 g/mol. Its IUPAC name is N'-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111207990 |
| Molecular Formula | C23H32ClN7 |
| Molecular Weight | 442.01 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N'-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCN(c2cc(Cl)ccc2C)C1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C23H32ClN7/c1-3-25-22(29-11-13-30(14-12-29)23-26-8-4-9-27-23)28-16-19-7-10-31(17-19)21-15-20(24)6-5-18(21)2/h4-6,8-9,15,19H,3,7,10-14,16-17H2,1-2H3,(H,25,28) |
| InChIKey | UDSIDQXCGXDCLM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.01 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|