C20H31N3O2 — CID 111255311
methyl 1-[N'-[2-(2,4-dimethylphenyl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111255311) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is methyl 1-[N'-[2-(2,4-dimethylphenyl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N'-[2-(2,4-dimethylphenyl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111255311 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | methyl 1-[N'-[2-(2,4-dimethylphenyl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CCc1ccc(C)cc1C)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C20H31N3O2/c1-5-21-20(23-12-9-18(10-13-23)19(24)25-4)22-11-8-17-7-6-15(2)14-16(17)3/h6-7,14,18H,5,8-13H2,1-4H3,(H,21,22) |
| InChIKey | JNHOFXDOWIVLEL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|